Organic acids and derivatives
Filtered Search Results
2,4,6-Trimethylphenylboronic Acid 98.0+%, TCI America™
CAS: 5980-97-2 Molecular Formula: C9H13BO2 Molecular Weight (g/mol): 164.011 MDL Number: MFCD00236060 InChI Key: BZXQRXJJJUZZAJ-UHFFFAOYSA-N Synonym: mesitylboronic acid,2,4,6-trimethylbenzeneboronic acid,2-mesityleneboronic acid,2,4,6-trimethylphenyl boronic acid,2,4,6-trimethylphenyl boranediol,boronic acid, 2,4,6-trimethylphenyl,2,4,6-trimethylboronic acid,boronic acid, b-2,4,6-trimethylphenyl,mesityl boronic acid,pubchem7895 PubChem CID: 292184 IUPAC Name: (2,4,6-trimethylphenyl)boronic acid SMILES: B(C1=C(C=C(C=C1C)C)C)(O)O
| PubChem CID | 292184 |
|---|---|
| CAS | 5980-97-2 |
| Molecular Weight (g/mol) | 164.011 |
| MDL Number | MFCD00236060 |
| SMILES | B(C1=C(C=C(C=C1C)C)C)(O)O |
| Synonym | mesitylboronic acid,2,4,6-trimethylbenzeneboronic acid,2-mesityleneboronic acid,2,4,6-trimethylphenyl boronic acid,2,4,6-trimethylphenyl boranediol,boronic acid, 2,4,6-trimethylphenyl,2,4,6-trimethylboronic acid,boronic acid, b-2,4,6-trimethylphenyl,mesityl boronic acid,pubchem7895 |
| IUPAC Name | (2,4,6-trimethylphenyl)boronic acid |
| InChI Key | BZXQRXJJJUZZAJ-UHFFFAOYSA-N |
| Molecular Formula | C9H13BO2 |
Scandium(III) Trifluoromethanesulfonate 98.0+%, TCI America™
CAS: 144026-79-9 Molecular Formula: C3F9O9S3Sc Molecular Weight (g/mol): 492.146 MDL Number: MFCD00192433 InChI Key: HZXJVDYQRYYYOR-UHFFFAOYSA-K Synonym: scandium iii trifluoromethanesulfonate,scandium trifluoromethanesulfonate,scandium iii triflate,scandium triflate,sc otf 3,scandium 3+ ; trifluoromethanesulfonate,trifluoromethanesulfonic acid scandium iii salt,scandium iii trifluoromethanesulphonate,scandium tris trifluoromethanesulfonate,scandiumtriflate PubChem CID: 2734571 IUPAC Name: scandium(3+);trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Sc+3]
| PubChem CID | 2734571 |
|---|---|
| CAS | 144026-79-9 |
| Molecular Weight (g/mol) | 492.146 |
| MDL Number | MFCD00192433 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Sc+3] |
| Synonym | scandium iii trifluoromethanesulfonate,scandium trifluoromethanesulfonate,scandium iii triflate,scandium triflate,sc otf 3,scandium 3+ ; trifluoromethanesulfonate,trifluoromethanesulfonic acid scandium iii salt,scandium iii trifluoromethanesulphonate,scandium tris trifluoromethanesulfonate,scandiumtriflate |
| IUPAC Name | scandium(3+);trifluoromethanesulfonate |
| InChI Key | HZXJVDYQRYYYOR-UHFFFAOYSA-K |
| Molecular Formula | C3F9O9S3Sc |
Methyl 2-Thiophenecarboxylate 99.0+%, TCI America™
CAS: 5380-42-7 Molecular Formula: C6H6O2S Molecular Weight (g/mol): 142.17 MDL Number: MFCD00016895 InChI Key: PGBFYLVIMDQYMS-UHFFFAOYSA-N Synonym: methyl 2-thiophenecarboxylate,methyl thenoate,methylthiophene-2-carboxylate,2-thiophenecarboxylic acid methyl ester,2-carbomethoxy thiophene,2-thiophenecarboxylic acid, methyl ester,thiophenate methyl,2-methoxycarbonyl thiophene,methyl 2-thiophene carboxylate,thiophenate-methyl PubChem CID: 79340 IUPAC Name: methyl thiophene-2-carboxylate SMILES: COC(=O)C1=CC=CS1
| PubChem CID | 79340 |
|---|---|
| CAS | 5380-42-7 |
| Molecular Weight (g/mol) | 142.17 |
| MDL Number | MFCD00016895 |
| SMILES | COC(=O)C1=CC=CS1 |
| Synonym | methyl 2-thiophenecarboxylate,methyl thenoate,methylthiophene-2-carboxylate,2-thiophenecarboxylic acid methyl ester,2-carbomethoxy thiophene,2-thiophenecarboxylic acid, methyl ester,thiophenate methyl,2-methoxycarbonyl thiophene,methyl 2-thiophene carboxylate,thiophenate-methyl |
| IUPAC Name | methyl thiophene-2-carboxylate |
| InChI Key | PGBFYLVIMDQYMS-UHFFFAOYSA-N |
| Molecular Formula | C6H6O2S |
Ethyl m-Tolylacetate 98.0+%, TCI America™
CAS: 40061-55-0 Molecular Formula: C11H14O2 Molecular Weight (g/mol): 178.231 MDL Number: MFCD00017273 InChI Key: RVIWPVAVHHVQIR-UHFFFAOYSA-N Synonym: ethyl m-tolylacetate,ethyl 2-3-methylphenyl acetate,ethyl meta-tolylacetate,ethyl 3-methylphenylacetate,m-tolylacetic acid ethyl ester,ethyl 2-m-tolyl acetate,benzeneacetic acid, 3-methyl-, ethyl ester,ethyl m-methylphenylacetate,3-methylphenylacetic acid ethyl ester,ethylm-tolylacetate PubChem CID: 96574 IUPAC Name: ethyl 2-(3-methylphenyl)acetate SMILES: CCOC(=O)CC1=CC=CC(=C1)C
| PubChem CID | 96574 |
|---|---|
| CAS | 40061-55-0 |
| Molecular Weight (g/mol) | 178.231 |
| MDL Number | MFCD00017273 |
| SMILES | CCOC(=O)CC1=CC=CC(=C1)C |
| Synonym | ethyl m-tolylacetate,ethyl 2-3-methylphenyl acetate,ethyl meta-tolylacetate,ethyl 3-methylphenylacetate,m-tolylacetic acid ethyl ester,ethyl 2-m-tolyl acetate,benzeneacetic acid, 3-methyl-, ethyl ester,ethyl m-methylphenylacetate,3-methylphenylacetic acid ethyl ester,ethylm-tolylacetate |
| IUPAC Name | ethyl 2-(3-methylphenyl)acetate |
| InChI Key | RVIWPVAVHHVQIR-UHFFFAOYSA-N |
| Molecular Formula | C11H14O2 |
S-Ethyl Trifluorothioacetate 98.0+%, TCI America™
CAS: 383-64-2 Molecular Formula: C4H5F3OS Molecular Weight (g/mol): 158.138 MDL Number: MFCD00000421 InChI Key: VGGUKFAVHPGNBF-UHFFFAOYSA-N Synonym: s-ethyl trifluorothioacetate,ethanethioic acid, trifluoro-, s-ethyl ester,ethyl trifluorothiolacetate,s-ethyl trifluoroethanethioate,trifluoroacetonylmercaptoethanol,acetic acid, trifluorothio-, s-ethyl ester,s-ethylthiotrifluoroacetate,trifluorothioacetic acid s-ethyl ester,ethanethioic acid, 2,2,2-trifluoro-, s-ethyl ester,1-ethylsulfanyl-2,2,2-trifluoroethanone PubChem CID: 67844 IUPAC Name: S-ethyl 2,2,2-trifluoroethanethioate SMILES: CCSC(=O)C(F)(F)F
| PubChem CID | 67844 |
|---|---|
| CAS | 383-64-2 |
| Molecular Weight (g/mol) | 158.138 |
| MDL Number | MFCD00000421 |
| SMILES | CCSC(=O)C(F)(F)F |
| Synonym | s-ethyl trifluorothioacetate,ethanethioic acid, trifluoro-, s-ethyl ester,ethyl trifluorothiolacetate,s-ethyl trifluoroethanethioate,trifluoroacetonylmercaptoethanol,acetic acid, trifluorothio-, s-ethyl ester,s-ethylthiotrifluoroacetate,trifluorothioacetic acid s-ethyl ester,ethanethioic acid, 2,2,2-trifluoro-, s-ethyl ester,1-ethylsulfanyl-2,2,2-trifluoroethanone |
| IUPAC Name | S-ethyl 2,2,2-trifluoroethanethioate |
| InChI Key | VGGUKFAVHPGNBF-UHFFFAOYSA-N |
| Molecular Formula | C4H5F3OS |
2-(Trifluoromethyl)pyridine-5-boronic Acid (contains varying amounts of Anhydride), TCI America™
CAS: 868662-36-6 Molecular Formula: C6H5BF3NO2 Molecular Weight (g/mol): 190.916 MDL Number: MFCD07375381 InChI Key: BNTIPMNMTIAWIW-UHFFFAOYSA-N Synonym: 2-trifluoromethyl pyridine-5-boronic acid,6-trifluoromethyl pyridin-3-yl boronic acid,2-trifluoromethyl-5-pyridineboric acid,2-trifluoromethyl pyridin-5-ylboronic acid,6-trifluoromethyl pyridine-3-boronic acid,6-trifluoromethyl pyridin-3-ylboronic acid,2-trifluoromethylpyridine-5-boronic acid,2-trifluoromethyl-5-pyridineboronic acid,6-trifluoromethyl-3-pyridylboronic acid PubChem CID: 25134278 IUPAC Name: [6-(trifluoromethyl)pyridin-3-yl]boronic acid SMILES: B(C1=CN=C(C=C1)C(F)(F)F)(O)O
| PubChem CID | 25134278 |
|---|---|
| CAS | 868662-36-6 |
| Molecular Weight (g/mol) | 190.916 |
| MDL Number | MFCD07375381 |
| SMILES | B(C1=CN=C(C=C1)C(F)(F)F)(O)O |
| Synonym | 2-trifluoromethyl pyridine-5-boronic acid,6-trifluoromethyl pyridin-3-yl boronic acid,2-trifluoromethyl-5-pyridineboric acid,2-trifluoromethyl pyridin-5-ylboronic acid,6-trifluoromethyl pyridine-3-boronic acid,6-trifluoromethyl pyridin-3-ylboronic acid,2-trifluoromethylpyridine-5-boronic acid,2-trifluoromethyl-5-pyridineboronic acid,6-trifluoromethyl-3-pyridylboronic acid |
| IUPAC Name | [6-(trifluoromethyl)pyridin-3-yl]boronic acid |
| InChI Key | BNTIPMNMTIAWIW-UHFFFAOYSA-N |
| Molecular Formula | C6H5BF3NO2 |
Dimethyl L-(+)-Tartrate 98.0+%, TCI America™
CAS: 608-68-4 Molecular Formula: C6H10O6 Molecular Weight (g/mol): 178.14 MDL Number: MFCD00064437 InChI Key: PVRATXCXJDHJJN-QWWZWVQMSA-N Synonym: +-dimethyl l-tartrate,dimethyl l-tartrate,2r,3r-dimethyl 2,3-dihydroxysuccinate,dimethyl +-tartrate,l-+-tartaric acid dimethyl ester,dimethyl l-+-tartrate,1,4-dimethyl 2r,3r-2,3-dihydroxybutanedioate,butanedioic acid, 2,3-dihydroxy-2r,3r-, 1,4-dimethyl ester,dimethyl 2r,3r-2,3-dihydroxybutanedioate,l-tartaric acid, dimethyl ester PubChem CID: 11851 IUPAC Name: dimethyl (2R,3R)-2,3-dihydroxybutanedioate SMILES: COC(=O)C(C(C(=O)OC)O)O
| PubChem CID | 11851 |
|---|---|
| CAS | 608-68-4 |
| Molecular Weight (g/mol) | 178.14 |
| MDL Number | MFCD00064437 |
| SMILES | COC(=O)C(C(C(=O)OC)O)O |
| Synonym | +-dimethyl l-tartrate,dimethyl l-tartrate,2r,3r-dimethyl 2,3-dihydroxysuccinate,dimethyl +-tartrate,l-+-tartaric acid dimethyl ester,dimethyl l-+-tartrate,1,4-dimethyl 2r,3r-2,3-dihydroxybutanedioate,butanedioic acid, 2,3-dihydroxy-2r,3r-, 1,4-dimethyl ester,dimethyl 2r,3r-2,3-dihydroxybutanedioate,l-tartaric acid, dimethyl ester |
| IUPAC Name | dimethyl (2R,3R)-2,3-dihydroxybutanedioate |
| InChI Key | PVRATXCXJDHJJN-QWWZWVQMSA-N |
| Molecular Formula | C6H10O6 |
3,4,6-Tri-O-acetyl-2-deoxy-D-glucopyranose 98.0+%, TCI America™
CAS: 69503-94-2 Molecular Formula: C12H18O8 Molecular Weight (g/mol): 290.268 MDL Number: MFCD06797168 InChI Key: KQMOFVGDOWGPPD-QFEGIVONSA-N Synonym: 2-Deoxy-D-glucopyranose 3,4,6-Triacetate PubChem CID: 11748278 IUPAC Name: [(2R,3S,4R)-3,4-diacetyloxy-6-hydroxyoxan-2-yl]methyl acetate SMILES: CC(=O)OCC1C(C(CC(O1)O)OC(=O)C)OC(=O)C
| PubChem CID | 11748278 |
|---|---|
| CAS | 69503-94-2 |
| Molecular Weight (g/mol) | 290.268 |
| MDL Number | MFCD06797168 |
| SMILES | CC(=O)OCC1C(C(CC(O1)O)OC(=O)C)OC(=O)C |
| Synonym | 2-Deoxy-D-glucopyranose 3,4,6-Triacetate |
| IUPAC Name | [(2R,3S,4R)-3,4-diacetyloxy-6-hydroxyoxan-2-yl]methyl acetate |
| InChI Key | KQMOFVGDOWGPPD-QFEGIVONSA-N |
| Molecular Formula | C12H18O8 |
Neodymium(III) Trifluoromethanesulfonate 97.0+%, TCI America™
CAS: 34622-08-7 Molecular Formula: C3F9NdO9S3 Molecular Weight (g/mol): 591.432 MDL Number: MFCD00192343 InChI Key: WYRSPTDNOIZOGA-UHFFFAOYSA-K Synonym: neodymium iii trifluoromethanesulfonate,neodymium iii triflate,neodymium trifluoromethanesulfonate,trifluoromethanesulfonic acid neodymium iii salt,nd otf 3,neodymium triflate,acmc-209i8y,neodymium 3+ ion tritriflate,neodymium perfluoromethanesulfonate,neodymium 3+ ; trifluoromethanesulfonate PubChem CID: 2733937 IUPAC Name: neodymium(3+);trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Nd+3]
| PubChem CID | 2733937 |
|---|---|
| CAS | 34622-08-7 |
| Molecular Weight (g/mol) | 591.432 |
| MDL Number | MFCD00192343 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].C(F)(F)(F)S(=O)(=O)[O-].[Nd+3] |
| Synonym | neodymium iii trifluoromethanesulfonate,neodymium iii triflate,neodymium trifluoromethanesulfonate,trifluoromethanesulfonic acid neodymium iii salt,nd otf 3,neodymium triflate,acmc-209i8y,neodymium 3+ ion tritriflate,neodymium perfluoromethanesulfonate,neodymium 3+ ; trifluoromethanesulfonate |
| IUPAC Name | neodymium(3+);trifluoromethanesulfonate |
| InChI Key | WYRSPTDNOIZOGA-UHFFFAOYSA-K |
| Molecular Formula | C3F9NdO9S3 |
2-Thiophenesulfonamide 98.0+%, TCI America™
CAS: 6339-87-3 Molecular Formula: C4H5NO2S2 Molecular Weight (g/mol): 163.209 MDL Number: MFCD00185853 InChI Key: KTFDYVNEGTXQCV-UHFFFAOYSA-N PubChem CID: 72881 ChEBI: CHEBI:79403 IUPAC Name: thiophene-2-sulfonamide SMILES: C1=CSC(=C1)S(=O)(=O)N
| PubChem CID | 72881 |
|---|---|
| CAS | 6339-87-3 |
| Molecular Weight (g/mol) | 163.209 |
| ChEBI | CHEBI:79403 |
| MDL Number | MFCD00185853 |
| SMILES | C1=CSC(=C1)S(=O)(=O)N |
| IUPAC Name | thiophene-2-sulfonamide |
| InChI Key | KTFDYVNEGTXQCV-UHFFFAOYSA-N |
| Molecular Formula | C4H5NO2S2 |
Tribromoacetic Acid 98.0+%, TCI America™
CAS: 75-96-7 Molecular Formula: C2HBr3O2 Molecular Weight (g/mol): 296.74 MDL Number: MFCD00004167 InChI Key: QIONYIKHPASLHO-UHFFFAOYSA-N Synonym: tribromoacetic acid,acetic acid, tribromo,tribromacetic acid,unii-71ktl99qjx,ccris 7887,71ktl99qjx,acetic acid, 2,2,2-tribromo,snpljqbkdvidtaetp@,dsstox_cid_1668,acmc-209p0y PubChem CID: 6415 IUPAC Name: 2,2,2-tribromoacetic acid SMILES: C(=O)(C(Br)(Br)Br)O
| PubChem CID | 6415 |
|---|---|
| CAS | 75-96-7 |
| Molecular Weight (g/mol) | 296.74 |
| MDL Number | MFCD00004167 |
| SMILES | C(=O)(C(Br)(Br)Br)O |
| Synonym | tribromoacetic acid,acetic acid, tribromo,tribromacetic acid,unii-71ktl99qjx,ccris 7887,71ktl99qjx,acetic acid, 2,2,2-tribromo,snpljqbkdvidtaetp@,dsstox_cid_1668,acmc-209p0y |
| IUPAC Name | 2,2,2-tribromoacetic acid |
| InChI Key | QIONYIKHPASLHO-UHFFFAOYSA-N |
| Molecular Formula | C2HBr3O2 |
alpha-Bromophenylacetic Acid 98.0+%, TCI America™
CAS: 4870-65-9 Molecular Formula: C8H7BrO2 Molecular Weight (g/mol): 215.046 MDL Number: MFCD00004206 InChI Key: WAKFRZBXTKUFIW-UHFFFAOYSA-N Synonym: alpha-bromophenylacetic acid,bromo phenyl acetic acid,.alpha.-bromophenylacetic acid,bromophenylacetic acid,bromo-phenyl-acetic acid,bromo-phenylacetic acid,dl-.alpha.-bromophenylacetic acid,benzeneacetic acid, .alpha.-bromo,phenylbromoacetic acid,bromo phenyl aceticacid PubChem CID: 97919 IUPAC Name: 2-bromo-2-phenylacetic acid SMILES: C1=CC=C(C=C1)C(C(=O)O)Br
| PubChem CID | 97919 |
|---|---|
| CAS | 4870-65-9 |
| Molecular Weight (g/mol) | 215.046 |
| MDL Number | MFCD00004206 |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)Br |
| Synonym | alpha-bromophenylacetic acid,bromo phenyl acetic acid,.alpha.-bromophenylacetic acid,bromophenylacetic acid,bromo-phenyl-acetic acid,bromo-phenylacetic acid,dl-.alpha.-bromophenylacetic acid,benzeneacetic acid, .alpha.-bromo,phenylbromoacetic acid,bromo phenyl aceticacid |
| IUPAC Name | 2-bromo-2-phenylacetic acid |
| InChI Key | WAKFRZBXTKUFIW-UHFFFAOYSA-N |
| Molecular Formula | C8H7BrO2 |
Butyl 2-Bromopropionate 95.0+%, TCI America™
CAS: 41145-84-0 Molecular Formula: C7H13BrO2 Molecular Weight (g/mol): 209.083 MDL Number: MFCD00059469 InChI Key: INMAEXGIVZJYIJ-UHFFFAOYSA-N Synonym: 2-Bromopropionic Acid Butyl Ester PubChem CID: 521024 IUPAC Name: butyl 2-bromopropanoate SMILES: CCCCOC(=O)C(C)Br
| PubChem CID | 521024 |
|---|---|
| CAS | 41145-84-0 |
| Molecular Weight (g/mol) | 209.083 |
| MDL Number | MFCD00059469 |
| SMILES | CCCCOC(=O)C(C)Br |
| Synonym | 2-Bromopropionic Acid Butyl Ester |
| IUPAC Name | butyl 2-bromopropanoate |
| InChI Key | INMAEXGIVZJYIJ-UHFFFAOYSA-N |
| Molecular Formula | C7H13BrO2 |
Benzyl Bromoacetate 96.0+%, TCI America™
CAS: 5437-45-6 Molecular Formula: C9H9BrO2 Molecular Weight (g/mol): 229.073 MDL Number: MFCD00000190 InChI Key: JHVLLYQQQYIWKX-UHFFFAOYSA-N Synonym: benzyl bromoacetate,bromoacetic acid benzyl ester,acetic acid, bromo-, phenylmethyl ester,merbac 35,caswell no. 082a,acetic acid, bromo-, benzyl ester,unii-64u2rk18d3,phenylmethyl 2-bromoacetate,epa pesticide chemical code 008710,benzyl bromacetate PubChem CID: 62576 IUPAC Name: benzyl 2-bromoacetate SMILES: C1=CC=C(C=C1)COC(=O)CBr
| PubChem CID | 62576 |
|---|---|
| CAS | 5437-45-6 |
| Molecular Weight (g/mol) | 229.073 |
| MDL Number | MFCD00000190 |
| SMILES | C1=CC=C(C=C1)COC(=O)CBr |
| Synonym | benzyl bromoacetate,bromoacetic acid benzyl ester,acetic acid, bromo-, phenylmethyl ester,merbac 35,caswell no. 082a,acetic acid, bromo-, benzyl ester,unii-64u2rk18d3,phenylmethyl 2-bromoacetate,epa pesticide chemical code 008710,benzyl bromacetate |
| IUPAC Name | benzyl 2-bromoacetate |
| InChI Key | JHVLLYQQQYIWKX-UHFFFAOYSA-N |
| Molecular Formula | C9H9BrO2 |
Ethyl Difluoroacetate 98.0+%, TCI America™
CAS: 454-31-9 Molecular Formula: C4H6F2O2 Molecular Weight (g/mol): 124.087 MDL Number: MFCD00013578 InChI Key: GZKHDVAKKLTJPO-UHFFFAOYSA-N Synonym: ethyl difluoroacetate,acetic acid, difluoro-, ethyl ester,difluoroacetic acid ethyl ester,ethyldifluoroacetate,ethyl difluoroacetic,ethyl difluoro acetate,difluoro-acetic acid ethyl ester,ethyl difluoroacetic acid,acetic acid, 2,2-difluoro-, ethyl ester,ethyldifluoracetat PubChem CID: 9961 IUPAC Name: ethyl 2,2-difluoroacetate SMILES: CCOC(=O)C(F)F
| PubChem CID | 9961 |
|---|---|
| CAS | 454-31-9 |
| Molecular Weight (g/mol) | 124.087 |
| MDL Number | MFCD00013578 |
| SMILES | CCOC(=O)C(F)F |
| Synonym | ethyl difluoroacetate,acetic acid, difluoro-, ethyl ester,difluoroacetic acid ethyl ester,ethyldifluoroacetate,ethyl difluoroacetic,ethyl difluoro acetate,difluoro-acetic acid ethyl ester,ethyl difluoroacetic acid,acetic acid, 2,2-difluoro-, ethyl ester,ethyldifluoracetat |
| IUPAC Name | ethyl 2,2-difluoroacetate |
| InChI Key | GZKHDVAKKLTJPO-UHFFFAOYSA-N |
| Molecular Formula | C4H6F2O2 |